C20H30ClNO — CID 19833506
2-but-3-en-2-yl-4,8a-dimethyl-9-(methylamino)-4b,5,6,7,8,9-hexahydrofluoren-1-ol;hydrochloride (PubChem CID 19833506) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is 2-but-3-en-2-yl-4,8a-dimethyl-9-(methylamino)-4b,5,6,7,8,9-hexahydrofluoren-1-ol;hydrochloride.
| Compound Name | 2-but-3-en-2-yl-4,8a-dimethyl-9-(methylamino)-4b,5,6,7,8,9-hexahydrofluoren-1-ol;hydrochloride |
|---|---|
| PubChem CID | 19833506 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-but-3-en-2-yl-4,8a-dimethyl-9-(methylamino)-4b,5,6,7,8,9-hexahydrofluoren-1-ol;hydrochloride |
| SMILES | C=CC(C)c1cc(C)c2c(c1O)C(NC)C1(C)CCCCC21.Cl |
| InChI | InChI=1S/C20H29NO.ClH/c1-6-12(2)14-11-13(3)16-15-9-7-8-10-20(15,4)19(21-5)17(16)18(14)22;/h6,11-12,15,19,21-22H,1,7-10H2,2-5H3;1H |
| InChIKey | BBFDRERZMFMZTE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|