C23H24N2O2 — CID 19833913
ethyl N-[(2E,4E)-hexa-2,4-dienoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833913) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl N-[(2E,4E)-hexa-2,4-dienoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | ethyl N-[(2E,4E)-hexa-2,4-dienoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 19833913 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl N-[(2E,4E)-hexa-2,4-dienoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | C/C=C/C=C/C(=O)/N=C(\OCC)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C23H24N2O2/c1-3-5-6-15-22(26)24-23(27-4-2)25-16-18-11-7-9-13-20(18)21-14-10-8-12-19(21)17-25/h3,5-15H,4,16-17H2,1-2H3/b5-3+,15-6+,24-23- |
| InChIKey | JIWNHTOBKPGITL-BEGHECNQSA-N |
| XLogP | 4.72 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|