About ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate
ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833915) has the molecular formula C19H19ClN2O2
and a molecular weight of 342.83 g/mol. Its IUPAC name is ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
Molecular Properties
| Compound Name | ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| PubChem CID | 19833915 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | CCO/C(=N\C(=O)CCl)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-2-24-19(21-18(23)11-20)22-12-14-7-3-5-9-16(14)17-10-6-4-8-15(17)13-22/h3-10H,2,11-13H2,1H3/b21-19- |
| InChIKey | RNKIQZZGLIMILC-VZCXRCSSSA-N |
| XLogP | 3.83 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The IUPAC name of ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (CID 19833915) is ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
What is the SMILES notation for ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The canonical SMILES for ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is CCO/C(=N\C(=O)CCl)N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The InChIKey is RNKIQZZGLIMILC-VZCXRCSSSA-N. The full InChI is InChI=1S/C19H19ClN2O2/c1-2-24-19(21-18(23)11-20)22-12-14-7-3-5-9-16(14)17-10-6-4-8-15(17)13-22/h3-10H,2,11-13H2,1H3/b21-19-.
What are the key properties of ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate has a molecular weight of 342.83 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2-chloroacetyl)-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is sourced from PubChem (CID 19833915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).