About ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate
ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833916) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
Molecular Properties
| Compound Name | ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| PubChem CID | 19833916 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | CCO/C(=N\C(C)=O)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C19H20N2O2/c1-3-23-19(20-14(2)22)21-12-15-8-4-6-10-17(15)18-11-7-5-9-16(18)13-21/h4-11H,3,12-13H2,1-2H3/b20-19- |
| InChIKey | QUHZKZYNKYNEGA-VXPUYCOJSA-N |
| XLogP | 3.61 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The IUPAC name of ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (CID 19833916) is ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
What is the SMILES notation for ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The canonical SMILES for ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is CCO/C(=N\C(C)=O)N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The InChIKey is QUHZKZYNKYNEGA-VXPUYCOJSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-3-23-19(20-14(2)22)21-12-15-8-4-6-10-17(15)18-11-7-5-9-16(18)13-21/h4-11H,3,12-13H2,1-2H3/b20-19-.
What are the key properties of ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate has a molecular weight of 308.38 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-acetyl-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is sourced from PubChem (CID 19833916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).