About 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate
2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833923) has the molecular formula C23H22N2O
and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
Molecular Properties
| Compound Name | 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| PubChem CID | 19833923 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(\OCCc1ccccc1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C23H22N2O/c24-23(26-15-14-18-8-2-1-3-9-18)25-16-19-10-4-6-12-21(19)22-13-7-5-11-20(22)17-25/h1-13,24H,14-17H2/b24-23- |
| InChIKey | TUAGEBLFNWPGLQ-VHXPQNKSSA-N |
| XLogP | 4.86 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The IUPAC name of 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (CID 19833923) is 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
What is the SMILES notation for 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The canonical SMILES for 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is [H]/N=C(\OCCc1ccccc1)N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The InChIKey is TUAGEBLFNWPGLQ-VHXPQNKSSA-N. The full InChI is InChI=1S/C23H22N2O/c24-23(26-15-14-18-8-2-1-3-9-18)25-16-19-10-4-6-12-21(19)22-13-7-5-11-20(22)17-25/h1-13,24H,14-17H2/b24-23-.
What are the key properties of 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate has a molecular weight of 342.44 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is sourced from PubChem (CID 19833923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).