C36H60N2O6 — CID 19834297
[2,2,6,6-tetramethyl-1-[3-oxo-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropoxy]piperidin-4-yl] benzoate (PubChem CID 19834297) has the molecular formula C36H60N2O6 and a molecular weight of 616.88 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-1-[3-oxo-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropoxy]piperidin-4-yl] benzoate.
| Compound Name | [2,2,6,6-tetramethyl-1-[3-oxo-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropoxy]piperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 19834297 |
| Molecular Formula | C36H60N2O6 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | [2,2,6,6-tetramethyl-1-[3-oxo-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropoxy]piperidin-4-yl] benzoate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)CCON2C(C)(C)CC(OC(=O)c3ccccc3)CC2(C)C)CC1(C)C |
| InChI | InChI=1S/C36H60N2O6/c1-10-11-12-13-14-18-22-41-37-33(2,3)24-29(25-34(37,4)5)43-31(39)21-23-42-38-35(6,7)26-30(27-36(38,8)9)44-32(40)28-19-16-15-17-20-28/h15-17,19-20,29-30H,10-14,18,21-27H2,1-9H3 |
| InChIKey | NNJPUNRTKVOJGB-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|