About 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate
2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate (PubChem CID 19834464) has the molecular formula C16H19N3O8
and a molecular weight of 381.34 g/mol. Its IUPAC name is 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate.
Molecular Properties
| Compound Name | 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
| PubChem CID | 19834464 |
| Molecular Formula | C16H19N3O8 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
| SMILES | NC(=O)OCCOC(=O)OCC1NC(=O)C1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O8/c17-14(21)24-6-7-25-16(23)27-9-11-12(13(20)18-11)19-15(22)26-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H2,17,21)(H,18,20)(H,19,22) |
| InChIKey | HZDGDXFZAFGLDV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate?
The IUPAC name of 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate (CID 19834464) is 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate.
What is the SMILES notation for 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate?
The canonical SMILES for 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate is NC(=O)OCCOC(=O)OCC1NC(=O)C1NC(=O)OCc1ccccc1.
What is the InChIKey of 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate?
The InChIKey is HZDGDXFZAFGLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O8/c17-14(21)24-6-7-25-16(23)27-9-11-12(13(20)18-11)19-15(22)26-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H2,17,21)(H,18,20)(H,19,22).
What are the key properties of 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate?
2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate has a molecular weight of 381.34 g/mol, XLogP of 0.03, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyloxyethyl [4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate is sourced from PubChem (CID 19834464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).