C9H13N — CID 19835364
2-methyl-2,3,3a,4-tetrahydro-1H-indole (PubChem CID 19835364) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-methyl-2,3,3a,4-tetrahydro-1H-indole.
| Compound Name | 2-methyl-2,3,3a,4-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 19835364 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-methyl-2,3,3a,4-tetrahydro-1H-indole |
| SMILES | CC1CC2CC=CC=C2N1 |
| InChI | InChI=1S/C9H13N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-3,5,7-8,10H,4,6H2,1H3 |
| InChIKey | BMYIYMDQVYGPIN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |