C16H20O4 — CID 19835399
2-(4,4,7-trimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene)propanedioic acid (PubChem CID 19835399) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(4,4,7-trimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene)propanedioic acid.
| Compound Name | 2-(4,4,7-trimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene)propanedioic acid |
|---|---|
| PubChem CID | 19835399 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-(4,4,7-trimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene)propanedioic acid |
| SMILES | CC1=CC2=CC(=C(C(=O)O)C(=O)O)CC(C)(C)C2CC1 |
| InChI | InChI=1S/C16H20O4/c1-9-4-5-12-10(6-9)7-11(8-16(12,2)3)13(14(17)18)15(19)20/h6-7,12H,4-5,8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | IRBASXAMZFKVCB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|