C11H18ClNO2 — CID 19835696
[2,6-bis(methoxymethyl)phenyl]methanamine;hydrochloride (PubChem CID 19835696) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is [2,6-bis(methoxymethyl)phenyl]methanamine;hydrochloride.
| Compound Name | [2,6-bis(methoxymethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 19835696 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | [2,6-bis(methoxymethyl)phenyl]methanamine;hydrochloride |
| SMILES | COCc1cccc(COC)c1CN.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-13-7-9-4-3-5-10(8-14-2)11(9)6-12;/h3-5H,6-8,12H2,1-2H3;1H |
| InChIKey | AAVGOGPFZOBHEB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |