C28H53F3O2Si2 — CID 19835839
tert-butyl-dimethyl-[8,8,8-trifluoro-1-(5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl)octan-3-yl]oxysilane (PubChem CID 19835839) has the molecular formula C28H53F3O2Si2 and a molecular weight of 534.90 g/mol. Its IUPAC name is tert-butyl-dimethyl-[8,8,8-trifluoro-1-(5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl)octan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[8,8,8-trifluoro-1-(5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl)octan-3-yl]oxysilane |
|---|---|
| PubChem CID | 19835839 |
| Molecular Formula | C28H53F3O2Si2 |
| Molecular Weight | 534.90 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | tert-butyl-dimethyl-[8,8,8-trifluoro-1-(5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl)octan-3-yl]oxysilane |
| SMILES | C=CCC1C(CCC(CCCCC(F)(F)F)O[Si](C)(C)C(C)(C)C)=CCC1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H53F3O2Si2/c1-10-16-25-23(19-21-26(25)33-35(11-2,12-3)13-4)18-20-24(17-14-15-22-28(29,30)31)32-34(8,9)27(5,6)7/h10,19,24-26H,1,11-18,20-22H2,2-9H3 |
| InChIKey | VFUWVTWEJSFSPX-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.90 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|