About 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one
1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one (PubChem CID 19836018) has the molecular formula C13H15F3O3S
and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one |
| PubChem CID | 19836018 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one |
| SMILES | O=C(CCCCC(F)(F)F)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15F3O3S/c14-13(15,16)9-5-4-6-11(17)10-20(18,19)12-7-2-1-3-8-12/h1-3,7-8H,4-6,9-10H2 |
| InChIKey | QYVHIIQVGLVPBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one?
The IUPAC name of 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one (CID 19836018) is 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one.
What is the SMILES notation for 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one?
The canonical SMILES for 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one is O=C(CCCCC(F)(F)F)CS(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one?
The InChIKey is QYVHIIQVGLVPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O3S/c14-13(15,16)9-5-4-6-11(17)10-20(18,19)12-7-2-1-3-8-12/h1-3,7-8H,4-6,9-10H2.
What are the key properties of 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one?
1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one has a molecular weight of 308.32 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-7,7,7-trifluoroheptan-2-one is sourced from PubChem (CID 19836018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).