C21H37F3O4Si — CID 19836107
2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 19836107) has the molecular formula C21H37F3O4Si and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 19836107 |
| Molecular Formula | C21H37F3O4Si |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCC(F)(F)F)CCC1=CCC(O)C1CC(=O)O |
| InChI | InChI=1S/C21H37F3O4Si/c1-20(2,3)29(4,5)28-16(8-6-7-13-21(22,23)24)11-9-15-10-12-18(25)17(15)14-19(26)27/h10,16-18,25H,6-9,11-14H2,1-5H3,(H,26,27) |
| InChIKey | NJWPIWNCUFGWDD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|