C21H25F3O6S — CID 19836110
2-[2-[2-(benzenesulfonyl)-8,8,8-trifluoro-3-oxooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 19836110) has the molecular formula C21H25F3O6S and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-[2-[2-(benzenesulfonyl)-8,8,8-trifluoro-3-oxooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[2-[2-(benzenesulfonyl)-8,8,8-trifluoro-3-oxooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 19836110 |
| Molecular Formula | C21H25F3O6S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[2-[2-(benzenesulfonyl)-8,8,8-trifluoro-3-oxooctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | O=C(O)CC1C(CC(C(=O)CCCCC(F)(F)F)S(=O)(=O)c2ccccc2)=CCC1O |
| InChI | InChI=1S/C21H25F3O6S/c22-21(23,24)11-5-4-8-18(26)19(31(29,30)15-6-2-1-3-7-15)12-14-9-10-17(25)16(14)13-20(27)28/h1-3,6-7,9,16-17,19,25H,4-5,8,10-13H2,(H,27,28) |
| InChIKey | UCFCOLAHVLXRMS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|