C28H55F3O3Si2 — CID 19836152
3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol (PubChem CID 19836152) has the molecular formula C28H55F3O3Si2 and a molecular weight of 552.91 g/mol. Its IUPAC name is 3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol.
| Compound Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 19836152 |
| Molecular Formula | C28H55F3O3Si2 |
| Molecular Weight | 552.91 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
| SMILES | CC[Si](CC)(CC)OC1CC=C(CCC(CCCCC(F)(F)F)O[Si](C)(C)C(C)(C)C)C1CCCO |
| InChI | InChI=1S/C28H55F3O3Si2/c1-9-36(10-2,11-3)34-26-20-18-23(25(26)16-14-22-32)17-19-24(15-12-13-21-28(29,30)31)33-35(7,8)27(4,5)6/h18,24-26,32H,9-17,19-22H2,1-8H3 |
| InChIKey | LZWWZPZPHZGZKJ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.91 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|