C19H18ClN3O — CID 19837250
1-[(2E,4E)-5-(2-chlorophenyl)penta-2,4-dienyl]-3-pyridin-4-ylimidazolidin-2-one (PubChem CID 19837250) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 1-[(2E,4E)-5-(2-chlorophenyl)penta-2,4-dienyl]-3-pyridin-4-ylimidazolidin-2-one.
| Compound Name | 1-[(2E,4E)-5-(2-chlorophenyl)penta-2,4-dienyl]-3-pyridin-4-ylimidazolidin-2-one |
|---|---|
| PubChem CID | 19837250 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[(2E,4E)-5-(2-chlorophenyl)penta-2,4-dienyl]-3-pyridin-4-ylimidazolidin-2-one |
| SMILES | O=C1N(C/C=C/C=C/c2ccccc2Cl)CCN1c1ccncc1 |
| InChI | InChI=1S/C19H18ClN3O/c20-18-8-4-3-7-16(18)6-2-1-5-13-22-14-15-23(19(22)24)17-9-11-21-12-10-17/h1-12H,13-15H2/b5-1+,6-2+ |
| InChIKey | HYXWJYZSGRVHMR-IJIVKGSJSA-N |
| XLogP | 4.25 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|