C24H48Cl2N4O2 — CID 19837399
dimethyl-[2-[methyl-nonyl-[(2-oxopyrrolidin-1-yl)methyl]azaniumyl]ethyl]-[(2-oxopyrrolidin-1-yl)methyl]azanium dichloride (PubChem CID 19837399) has the molecular formula C24H48Cl2N4O2 and a molecular weight of 495.58 g/mol. Its IUPAC name is dimethyl-[2-[methyl-nonyl-[(2-oxopyrrolidin-1-yl)methyl]azaniumyl]ethyl]-[(2-oxopyrrolidin-1-yl)methyl]azanium dichloride.
| Compound Name | dimethyl-[2-[methyl-nonyl-[(2-oxopyrrolidin-1-yl)methyl]azaniumyl]ethyl]-[(2-oxopyrrolidin-1-yl)methyl]azanium dichloride |
|---|---|
| PubChem CID | 19837399 |
| Molecular Formula | C24H48Cl2N4O2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | dimethyl-[2-[methyl-nonyl-[(2-oxopyrrolidin-1-yl)methyl]azaniumyl]ethyl]-[(2-oxopyrrolidin-1-yl)methyl]azanium dichloride |
| SMILES | CCCCCCCCC[N+](C)(CC[N+](C)(C)CN1CCCC1=O)CN1CCCC1=O.[Cl-].[Cl-] |
| InChI | InChI=1S/C24H48N4O2.2ClH/c1-5-6-7-8-9-10-11-18-28(4,22-26-17-13-15-24(26)30)20-19-27(2,3)21-25-16-12-14-23(25)29;;/h5-22H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | RXGMTZFGNLVNHT-UHFFFAOYSA-L |
| XLogP | -2.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|