About (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine
(E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine (PubChem CID 19837432) has the molecular formula C20H42N2
and a molecular weight of 310.57 g/mol. Its IUPAC name is (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine |
| PubChem CID | 19837432 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine |
| SMILES | CCCCCCCCN(/C=C/N(C)C)CCCCCCCC |
| InChI | InChI=1S/C20H42N2/c1-5-7-9-11-13-15-17-22(20-19-21(3)4)18-16-14-12-10-8-6-2/h19-20H,5-18H2,1-4H3/b20-19+ |
| InChIKey | TUBJEWJPDPUJGK-FMQUCBEESA-N |
| XLogP | 6.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine?
The IUPAC name of (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine (CID 19837432) is (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine.
What is the SMILES notation for (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine?
The canonical SMILES for (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine is CCCCCCCCN(/C=C/N(C)C)CCCCCCCC.
What is the InChIKey of (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine?
The InChIKey is TUBJEWJPDPUJGK-FMQUCBEESA-N. The full InChI is InChI=1S/C20H42N2/c1-5-7-9-11-13-15-17-22(20-19-21(3)4)18-16-14-12-10-8-6-2/h19-20H,5-18H2,1-4H3/b20-19+.
What are the key properties of (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine?
(E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine has a molecular weight of 310.57 g/mol, XLogP of 6.04, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-N',N'-dioctylethene-1,2-diamine is sourced from PubChem (CID 19837432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).