About diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride
diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride (PubChem CID 19837445) has the molecular formula C10H19ClN2O5
and a molecular weight of 282.72 g/mol. Its IUPAC name is diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride.
Molecular Properties
| Compound Name | diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride |
| PubChem CID | 19837445 |
| Molecular Formula | C10H19ClN2O5 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride |
| SMILES | CCOC(=O)C(NC(=O)C(C)N)C(=O)OCC.Cl |
| InChI | InChI=1S/C10H18N2O5.ClH/c1-4-16-9(14)7(10(15)17-5-2)12-8(13)6(3)11;/h6-7H,4-5,11H2,1-3H3,(H,12,13);1H |
| InChIKey | ZPDIHWPESBDBRL-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride?
The IUPAC name of diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride (CID 19837445) is diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride.
What is the SMILES notation for diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride?
The canonical SMILES for diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride is CCOC(=O)C(NC(=O)C(C)N)C(=O)OCC.Cl.
What is the InChIKey of diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride?
The InChIKey is ZPDIHWPESBDBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O5.ClH/c1-4-16-9(14)7(10(15)17-5-2)12-8(13)6(3)11;/h6-7H,4-5,11H2,1-3H3,(H,12,13);1H.
What are the key properties of diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride?
diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride has a molecular weight of 282.72 g/mol, XLogP of -0.63, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(2-aminopropanoylamino)propanedioate;hydrochloride is sourced from PubChem (CID 19837445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).