C10H8ClN3O2 — CID 19837629
1-(2-chlorophenyl)-4-methoxy-1,3,5-triazin-2-one (PubChem CID 19837629) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-methoxy-1,3,5-triazin-2-one.
| Compound Name | 1-(2-chlorophenyl)-4-methoxy-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 19837629 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 1-(2-chlorophenyl)-4-methoxy-1,3,5-triazin-2-one |
| SMILES | COc1ncn(-c2ccccc2Cl)c(=O)n1 |
| InChI | InChI=1S/C10H8ClN3O2/c1-16-9-12-6-14(10(15)13-9)8-5-3-2-4-7(8)11/h2-6H,1H3 |
| InChIKey | AMDRHLNGLLQSCU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |