About (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane
(E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 19837825) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 19837825 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.O/C=C/CCO |
| InChI | InChI=1S/C6H10O3.C4H8O2/c1(5-3-8-5)7-2-6-4-9-6;5-3-1-2-4-6/h5-6H,1-4H2;1,3,5-6H,2,4H2/b;3-1+ |
| InChIKey | JWHSTNWEHAORCE-NBPLQZBRSA-N |
| XLogP | 0.24 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 19837825) is (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.O/C=C/CCO.
What is the InChIKey of (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is JWHSTNWEHAORCE-NBPLQZBRSA-N. The full InChI is InChI=1S/C6H10O3.C4H8O2/c1(5-3-8-5)7-2-6-4-9-6;5-3-1-2-4-6/h5-6H,1-4H2;1,3,5-6H,2,4H2/b;3-1+.
What are the key properties of (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
(E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 218.25 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-1-ene-1,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 19837825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).