About N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine
N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine (PubChem CID 19838345) has the molecular formula C16H34N4O4
and a molecular weight of 346.47 g/mol. Its IUPAC name is N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine.
Molecular Properties
| Compound Name | N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine |
| PubChem CID | 19838345 |
| Molecular Formula | C16H34N4O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine |
| SMILES | CC(C)(CCNCCCCCCNCCC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C16H34N4O4/c1-15(2,19(21)22)9-13-17-11-7-5-6-8-12-18-14-10-16(3,4)20(23)24/h17-18H,5-14H2,1-4H3 |
| InChIKey | YMQBIVAFWGMPPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine?
The IUPAC name of N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine (CID 19838345) is N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine.
What is the SMILES notation for N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine?
The canonical SMILES for N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine is CC(C)(CCNCCCCCCNCCC(C)(C)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine?
The InChIKey is YMQBIVAFWGMPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N4O4/c1-15(2,19(21)22)9-13-17-11-7-5-6-8-12-18-14-10-16(3,4)20(23)24/h17-18H,5-14H2,1-4H3.
What are the key properties of N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine?
N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine has a molecular weight of 346.47 g/mol, XLogP of 2.62, 15 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-methyl-3-nitrobutyl)hexane-1,6-diamine is sourced from PubChem (CID 19838345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).