About N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine
N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine (PubChem CID 19838357) has the molecular formula C14H30N4O4
and a molecular weight of 318.42 g/mol. Its IUPAC name is N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine |
| PubChem CID | 19838357 |
| Molecular Formula | C14H30N4O4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine |
| SMILES | CC(C)(CCNCCCCNCCC(C)(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C14H30N4O4/c1-13(2,17(19)20)7-11-15-9-5-6-10-16-12-8-14(3,4)18(21)22/h15-16H,5-12H2,1-4H3 |
| InChIKey | IHPYZSFEVVTDCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine?
The IUPAC name of N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine (CID 19838357) is N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine.
What is the SMILES notation for N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine?
The canonical SMILES for N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine is CC(C)(CCNCCCCNCCC(C)(C)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine?
The InChIKey is IHPYZSFEVVTDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4O4/c1-13(2,17(19)20)7-11-15-9-5-6-10-16-12-8-14(3,4)18(21)22/h15-16H,5-12H2,1-4H3.
What are the key properties of N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine?
N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine has a molecular weight of 318.42 g/mol, XLogP of 1.84, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-methyl-3-nitrobutyl)butane-1,4-diamine is sourced from PubChem (CID 19838357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).