C18H33N5O8 — CID 19838410
2-[4,7-bis(carboxymethyl)-10-[2-(1-hydroxyethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 19838410) has the molecular formula C18H33N5O8 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(1-hydroxyethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1-hydroxyethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 19838410 |
| Molecular Formula | C18H33N5O8 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(1-hydroxyethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(O)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H33N5O8/c1-14(24)19-15(25)10-20-2-4-21(11-16(26)27)6-8-23(13-18(30)31)9-7-22(5-3-20)12-17(28)29/h14,24H,2-13H2,1H3,(H,19,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | ZSUFXSCUYFXBNR-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|