C32H31NO5S — CID 19838592
(6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-9,10-dioxo-4-phenylsulfanylanthracene-2-carboxylate (PubChem CID 19838592) has the molecular formula C32H31NO5S and a molecular weight of 541.67 g/mol. Its IUPAC name is (6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-9,10-dioxo-4-phenylsulfanylanthracene-2-carboxylate.
| Compound Name | (6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-9,10-dioxo-4-phenylsulfanylanthracene-2-carboxylate |
|---|---|
| PubChem CID | 19838592 |
| Molecular Formula | C32H31NO5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl) 1-amino-9,10-dioxo-4-phenylsulfanylanthracene-2-carboxylate |
| SMILES | COC1CCC2CC(OC(=O)c3cc(Sc4ccccc4)c4c(c3N)C(=O)c3ccccc3C4=O)CCC2C1 |
| InChI | InChI=1S/C32H31NO5S/c1-37-20-13-11-19-16-21(14-12-18(19)15-20)38-32(36)25-17-26(39-22-7-3-2-4-8-22)27-28(29(25)33)31(35)24-10-6-5-9-23(24)30(27)34/h2-10,17-21H,11-16,33H2,1H3 |
| InChIKey | YJRBRRWTOSTKJM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|