C23H18ClNO2S — CID 19838634
3-[(4-chlorophenyl)methyl]-5,6-diphenyl-1,3-thiazinane-2,4-dione (PubChem CID 19838634) has the molecular formula C23H18ClNO2S and a molecular weight of 407.92 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5,6-diphenyl-1,3-thiazinane-2,4-dione.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5,6-diphenyl-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 19838634 |
| Molecular Formula | C23H18ClNO2S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5,6-diphenyl-1,3-thiazinane-2,4-dione |
| SMILES | O=C1SC(c2ccccc2)C(c2ccccc2)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClNO2S/c24-19-13-11-16(12-14-19)15-25-22(26)20(17-7-3-1-4-8-17)21(28-23(25)27)18-9-5-2-6-10-18/h1-14,20-21H,15H2 |
| InChIKey | OXDSCURNDKLLHK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|