About 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one
1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one (PubChem CID 19838695) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 19838695 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one |
| SMILES | CC1CCN(CN2CCCC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H20N2O/c1-12-8-10-16(11-17-9-4-7-15(17)18)14-6-3-2-5-13(12)14/h2-3,5-6,12H,4,7-11H2,1H3 |
| InChIKey | PLRSJLYNHOZLHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one (CID 19838695) is 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one is CC1CCN(CN2CCCC2=O)c2ccccc21.
What is the InChIKey of 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one?
The InChIKey is PLRSJLYNHOZLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-12-8-10-16(11-17-9-4-7-15(17)18)14-6-3-2-5-13(12)14/h2-3,5-6,12H,4,7-11H2,1H3.
What are the key properties of 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one?
1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one has a molecular weight of 244.34 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 19838695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).