About 3,3-dimethyl-1,2-dihydropyrrole
3,3-dimethyl-1,2-dihydropyrrole (PubChem CID 19839114) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 3,3-dimethyl-1,2-dihydropyrrole.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,2-dihydropyrrole |
| PubChem CID | 19839114 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 3,3-dimethyl-1,2-dihydropyrrole |
| SMILES | CC1(C)C=CNC1 |
| InChI | InChI=1S/C6H11N/c1-6(2)3-4-7-5-6/h3-4,7H,5H2,1-2H3 |
| InChIKey | BBGNYPHMXUYYJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethyl-1,2-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,2-dihydropyrrole?
The IUPAC name of 3,3-dimethyl-1,2-dihydropyrrole (CID 19839114) is 3,3-dimethyl-1,2-dihydropyrrole.
What is the SMILES notation for 3,3-dimethyl-1,2-dihydropyrrole?
The canonical SMILES for 3,3-dimethyl-1,2-dihydropyrrole is CC1(C)C=CNC1.
What is the InChIKey of 3,3-dimethyl-1,2-dihydropyrrole?
The InChIKey is BBGNYPHMXUYYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-6(2)3-4-7-5-6/h3-4,7H,5H2,1-2H3.
What are the key properties of 3,3-dimethyl-1,2-dihydropyrrole?
3,3-dimethyl-1,2-dihydropyrrole has a molecular weight of 97.16 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,2-dihydropyrrole is sourced from PubChem (CID 19839114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).