About acetonitrile;2-methyl-5-propan-2-ylthiolane
acetonitrile;2-methyl-5-propan-2-ylthiolane (PubChem CID 19839133) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is acetonitrile;2-methyl-5-propan-2-ylthiolane.
Molecular Properties
| Compound Name | acetonitrile;2-methyl-5-propan-2-ylthiolane |
| PubChem CID | 19839133 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | acetonitrile;2-methyl-5-propan-2-ylthiolane |
| SMILES | CC#N.CC1CCC(C(C)C)S1 |
| InChI | InChI=1S/C8H16S.C2H3N/c1-6(2)8-5-4-7(3)9-8;1-2-3/h6-8H,4-5H2,1-3H3;1H3 |
| InChIKey | FLPPWYYERSMLNU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;2-methyl-5-propan-2-ylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-methyl-5-propan-2-ylthiolane?
The IUPAC name of acetonitrile;2-methyl-5-propan-2-ylthiolane (CID 19839133) is acetonitrile;2-methyl-5-propan-2-ylthiolane.
What is the SMILES notation for acetonitrile;2-methyl-5-propan-2-ylthiolane?
The canonical SMILES for acetonitrile;2-methyl-5-propan-2-ylthiolane is CC#N.CC1CCC(C(C)C)S1.
What is the InChIKey of acetonitrile;2-methyl-5-propan-2-ylthiolane?
The InChIKey is FLPPWYYERSMLNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S.C2H3N/c1-6(2)8-5-4-7(3)9-8;1-2-3/h6-8H,4-5H2,1-3H3;1H3.
What are the key properties of acetonitrile;2-methyl-5-propan-2-ylthiolane?
acetonitrile;2-methyl-5-propan-2-ylthiolane has a molecular weight of 185.34 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-methyl-5-propan-2-ylthiolane is sourced from PubChem (CID 19839133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).