C48H64O4S — CID 19839155
[(1E,3E,5E,7E,11E,13E,15E,17E)-10-(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,11,13,15,17-octaen-9-yl] acetate (PubChem CID 19839155) has the molecular formula C48H64O4S and a molecular weight of 737.10 g/mol. Its IUPAC name is [(1E,3E,5E,7E,11E,13E,15E,17E)-10-(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,11,13,15,17-octaen-9-yl] acetate.
| Compound Name | [(1E,3E,5E,7E,11E,13E,15E,17E)-10-(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,11,13,15,17-octaen-9-yl] acetate |
|---|---|
| PubChem CID | 19839155 |
| Molecular Formula | C48H64O4S |
| Molecular Weight | 737.10 g/mol |
| Exact Mass | 736.45 |
| IUPAC Name | [(1E,3E,5E,7E,11E,13E,15E,17E)-10-(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,11,13,15,17-octaen-9-yl] acetate |
| SMILES | CC(=O)OC(/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C(/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C48H64O4S/c1-35(27-29-43-39(5)23-17-31-47(43,8)9)19-15-21-37(3)33-45(52-41(7)49)46(53(50,51)42-25-13-12-14-26-42)34-38(4)22-16-20-36(2)28-30-44-40(6)24-18-32-48(44,10)11/h12-16,19-22,25-30,33-34,45-46H,17-18,23-24,31-32H2,1-11H3/b21-15+,22-16+,29-27+,30-28+,35-19+,36-20+,37-33+,38-34+ |
| InChIKey | PVZQBVTXDRAPPL-NGANDMTGSA-N |
| XLogP | 12.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.10 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|