C17H26O2 — CID 19839163
6,8,8-trimethyl-7-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 19839163) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 6,8,8-trimethyl-7-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | 6,8,8-trimethyl-7-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 19839163 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 6,8,8-trimethyl-7-[(1E,3E)-3-methylpenta-1,3-dienyl]-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | C/C=C(C)/C=C/C1=C(C)C2(CCC1(C)C)OCCO2 |
| InChI | InChI=1S/C17H26O2/c1-6-13(2)7-8-15-14(3)17(18-11-12-19-17)10-9-16(15,4)5/h6-8H,9-12H2,1-5H3/b8-7+,13-6+ |
| InChIKey | BGELJYJSMQWUFB-ATYMRYJVSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|