About (4-acetamidophenyl) 2-hydroxybenzoate
(4-acetamidophenyl) 2-hydroxybenzoate (PubChem CID 1984) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-hydroxybenzoate |
| PubChem CID | 1984 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (4-acetamidophenyl) 2-hydroxybenzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
| InChIKey | TWIIVLKQFJBFPW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-hydroxybenzoate?
The IUPAC name of (4-acetamidophenyl) 2-hydroxybenzoate (CID 1984) is (4-acetamidophenyl) 2-hydroxybenzoate.
What is the SMILES notation for (4-acetamidophenyl) 2-hydroxybenzoate?
The canonical SMILES for (4-acetamidophenyl) 2-hydroxybenzoate is CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1.
What is the InChIKey of (4-acetamidophenyl) 2-hydroxybenzoate?
The InChIKey is TWIIVLKQFJBFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17).
What are the key properties of (4-acetamidophenyl) 2-hydroxybenzoate?
(4-acetamidophenyl) 2-hydroxybenzoate has a molecular weight of 271.27 g/mol, XLogP of 2.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-hydroxybenzoate is sourced from PubChem (CID 1984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).