C23H30N2O — CID 19840055
(2E,4E,6E,8E)-1-(1H-imidazol-2-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 19840055) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (2E,4E,6E,8E)-1-(1H-imidazol-2-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-1-(1H-imidazol-2-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 19840055 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (2E,4E,6E,8E)-1-(1H-imidazol-2-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)c2ncc[nH]2)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H30N2O/c1-17(11-12-20-19(3)10-7-13-23(20,4)5)8-6-9-18(2)16-21(26)22-24-14-15-25-22/h6,8-9,11-12,14-16H,7,10,13H2,1-5H3,(H,24,25)/b9-6+,12-11+,17-8+,18-16+ |
| InChIKey | URYGMCILGWSRKP-LYKFAKFTSA-N |
| XLogP | 6.12 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|