About 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate
2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate (PubChem CID 19840066) has the molecular formula C24H44O6S3
and a molecular weight of 524.81 g/mol. Its IUPAC name is 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate.
Molecular Properties
| Compound Name | 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate |
| PubChem CID | 19840066 |
| Molecular Formula | C24H44O6S3 |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate |
| SMILES | CCCCC(S)C(=O)OCC(CC)(COC(=O)C(S)CCCC)COC(=O)C(S)CCCC |
| InChI | InChI=1S/C24H44O6S3/c1-5-9-12-18(31)21(25)28-15-24(8-4,16-29-22(26)19(32)13-10-6-2)17-30-23(27)20(33)14-11-7-3/h18-20,31-33H,5-17H2,1-4H3 |
| InChIKey | VZJOUJUCPCKXOM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate?
The IUPAC name of 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate (CID 19840066) is 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate.
What is the SMILES notation for 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate?
The canonical SMILES for 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate is CCCCC(S)C(=O)OCC(CC)(COC(=O)C(S)CCCC)COC(=O)C(S)CCCC.
What is the InChIKey of 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate?
The InChIKey is VZJOUJUCPCKXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O6S3/c1-5-9-12-18(31)21(25)28-15-24(8-4,16-29-22(26)19(32)13-10-6-2)17-30-23(27)20(33)14-11-7-3/h18-20,31-33H,5-17H2,1-4H3.
What are the key properties of 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate?
2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate has a molecular weight of 524.81 g/mol, XLogP of 5.48, 19 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-sulfanylhexanoyloxymethyl)butyl 2-sulfanylhexanoate is sourced from PubChem (CID 19840066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).