C23H26N2O3 — CID 19841101
methyl 2-[4-[(2-butylimidazol-1-yl)methyl]-2-methoxyphenyl]benzoate (PubChem CID 19841101) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl 2-[4-[(2-butylimidazol-1-yl)methyl]-2-methoxyphenyl]benzoate.
| Compound Name | methyl 2-[4-[(2-butylimidazol-1-yl)methyl]-2-methoxyphenyl]benzoate |
|---|---|
| PubChem CID | 19841101 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 2-[4-[(2-butylimidazol-1-yl)methyl]-2-methoxyphenyl]benzoate |
| SMILES | CCCCc1nccn1Cc1ccc(-c2ccccc2C(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-4-5-10-22-24-13-14-25(22)16-17-11-12-19(21(15-17)27-2)18-8-6-7-9-20(18)23(26)28-3/h6-9,11-15H,4-5,10,16H2,1-3H3 |
| InChIKey | OPLOKQQRSAWSOD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |