C14H12ClN3 — CID 19841388
5-chloro-8,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,5,7,9,12(17)-hexaene (PubChem CID 19841388) has the molecular formula C14H12ClN3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-chloro-8,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,5,7,9,12(17)-hexaene.
| Compound Name | 5-chloro-8,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,5,7,9,12(17)-hexaene |
|---|---|
| PubChem CID | 19841388 |
| Molecular Formula | C14H12ClN3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5-chloro-8,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,3,5,7,9,12(17)-hexaene |
| SMILES | Clc1ccc2c(c1)ncc1[nH]c3c(c12)CNCC3 |
| InChI | InChI=1S/C14H12ClN3/c15-8-1-2-9-12(5-8)17-7-13-14(9)10-6-16-4-3-11(10)18-13/h1-2,5,7,16,18H,3-4,6H2 |
| InChIKey | NSXANTBSVWKFCC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |