About 1,1-dicyclopentylguanidine
1,1-dicyclopentylguanidine (PubChem CID 19841614) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,1-dicyclopentylguanidine.
Molecular Properties
| Compound Name | 1,1-dicyclopentylguanidine |
| PubChem CID | 19841614 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1,1-dicyclopentylguanidine |
| SMILES | [H]/N=C(\N)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C11H21N3/c12-11(13)14(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2,(H3,12,13) |
| InChIKey | DVOLERQOUPHQMU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclopentylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclopentylguanidine?
The IUPAC name of 1,1-dicyclopentylguanidine (CID 19841614) is 1,1-dicyclopentylguanidine.
What is the SMILES notation for 1,1-dicyclopentylguanidine?
The canonical SMILES for 1,1-dicyclopentylguanidine is [H]/N=C(\N)N(C1CCCC1)C1CCCC1.
What is the InChIKey of 1,1-dicyclopentylguanidine?
The InChIKey is DVOLERQOUPHQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c12-11(13)14(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2,(H3,12,13).
What are the key properties of 1,1-dicyclopentylguanidine?
1,1-dicyclopentylguanidine has a molecular weight of 195.31 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclopentylguanidine is sourced from PubChem (CID 19841614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).