About 2-prop-2-ynoxyguanidine
2-prop-2-ynoxyguanidine (PubChem CID 19841616) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-prop-2-ynoxyguanidine.
Molecular Properties
| Compound Name | 2-prop-2-ynoxyguanidine |
| PubChem CID | 19841616 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 2-prop-2-ynoxyguanidine |
| SMILES | C#CCON=C(N)N |
| InChI | InChI=1S/C4H7N3O/c1-2-3-8-7-4(5)6/h1H,3H2,(H4,5,6,7) |
| InChIKey | MRJCPZRXAYDQSE-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynoxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynoxyguanidine?
The IUPAC name of 2-prop-2-ynoxyguanidine (CID 19841616) is 2-prop-2-ynoxyguanidine.
What is the SMILES notation for 2-prop-2-ynoxyguanidine?
The canonical SMILES for 2-prop-2-ynoxyguanidine is C#CCON=C(N)N.
What is the InChIKey of 2-prop-2-ynoxyguanidine?
The InChIKey is MRJCPZRXAYDQSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c1-2-3-8-7-4(5)6/h1H,3H2,(H4,5,6,7).
What are the key properties of 2-prop-2-ynoxyguanidine?
2-prop-2-ynoxyguanidine has a molecular weight of 113.12 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynoxyguanidine is sourced from PubChem (CID 19841616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).