About (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone
(2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone (PubChem CID 19841641) has the molecular formula C11H7ClFNO2S
and a molecular weight of 271.70 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone |
| PubChem CID | 19841641 |
| Molecular Formula | C11H7ClFNO2S |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1csc(Cl)n1)c1ccccc1OCF |
| InChI | InChI=1S/C11H7ClFNO2S/c12-11-14-8(5-17-11)10(15)7-3-1-2-4-9(7)16-6-13/h1-5H,6H2 |
| InChIKey | AGKBTVMDOKDRPL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone?
The IUPAC name of (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone (CID 19841641) is (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone.
What is the SMILES notation for (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone?
The canonical SMILES for (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone is O=C(c1csc(Cl)n1)c1ccccc1OCF.
What is the InChIKey of (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone?
The InChIKey is AGKBTVMDOKDRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClFNO2S/c12-11-14-8(5-17-11)10(15)7-3-1-2-4-9(7)16-6-13/h1-5H,6H2.
What are the key properties of (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone?
(2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone has a molecular weight of 271.70 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-4-yl)-[2-(fluoromethoxy)phenyl]methanone is sourced from PubChem (CID 19841641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).