About 2-oxo-1,3-thiazolidine-5-carbaldehyde
2-oxo-1,3-thiazolidine-5-carbaldehyde (PubChem CID 19841663) has the molecular formula C4H5NO2S
and a molecular weight of 131.16 g/mol. Its IUPAC name is 2-oxo-1,3-thiazolidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-oxo-1,3-thiazolidine-5-carbaldehyde |
| PubChem CID | 19841663 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 2-oxo-1,3-thiazolidine-5-carbaldehyde |
| SMILES | O=CC1CNC(=O)S1 |
| InChI | InChI=1S/C4H5NO2S/c6-2-3-1-5-4(7)8-3/h2-3H,1H2,(H,5,7) |
| InChIKey | KLOWITDEBHMZKP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1,3-thiazolidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3-thiazolidine-5-carbaldehyde?
The IUPAC name of 2-oxo-1,3-thiazolidine-5-carbaldehyde (CID 19841663) is 2-oxo-1,3-thiazolidine-5-carbaldehyde.
What is the SMILES notation for 2-oxo-1,3-thiazolidine-5-carbaldehyde?
The canonical SMILES for 2-oxo-1,3-thiazolidine-5-carbaldehyde is O=CC1CNC(=O)S1.
What is the InChIKey of 2-oxo-1,3-thiazolidine-5-carbaldehyde?
The InChIKey is KLOWITDEBHMZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S/c6-2-3-1-5-4(7)8-3/h2-3H,1H2,(H,5,7).
What are the key properties of 2-oxo-1,3-thiazolidine-5-carbaldehyde?
2-oxo-1,3-thiazolidine-5-carbaldehyde has a molecular weight of 131.16 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-thiazolidine-5-carbaldehyde is sourced from PubChem (CID 19841663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).