About methyl sulfate;morpholin-4-ium
methyl sulfate;morpholin-4-ium (PubChem CID 19842190) has the molecular formula C5H13NO5S
and a molecular weight of 199.23 g/mol. Its IUPAC name is methyl sulfate;morpholin-4-ium.
Molecular Properties
| Compound Name | methyl sulfate;morpholin-4-ium |
| PubChem CID | 19842190 |
| Molecular Formula | C5H13NO5S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | methyl sulfate;morpholin-4-ium |
| SMILES | C1COCC[NH2+]1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C4H9NO.CH4O4S/c1-3-6-4-2-5-1;1-5-6(2,3)4/h5H,1-4H2;1H3,(H,2,3,4) |
| InChIKey | MTDQTHOKIZBFQQ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methyl sulfate;morpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl sulfate;morpholin-4-ium?
The IUPAC name of methyl sulfate;morpholin-4-ium (CID 19842190) is methyl sulfate;morpholin-4-ium.
What is the SMILES notation for methyl sulfate;morpholin-4-ium?
The canonical SMILES for methyl sulfate;morpholin-4-ium is C1COCC[NH2+]1.COS(=O)(=O)[O-].
What is the InChIKey of methyl sulfate;morpholin-4-ium?
The InChIKey is MTDQTHOKIZBFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.CH4O4S/c1-3-6-4-2-5-1;1-5-6(2,3)4/h5H,1-4H2;1H3,(H,2,3,4).
What are the key properties of methyl sulfate;morpholin-4-ium?
methyl sulfate;morpholin-4-ium has a molecular weight of 199.23 g/mol, XLogP of -2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl sulfate;morpholin-4-ium is sourced from PubChem (CID 19842190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).