About N'-amino-N-iminomethanimidamide;anthracene-9,10-dione
N'-amino-N-iminomethanimidamide;anthracene-9,10-dione (PubChem CID 19842632) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is N'-amino-N-iminomethanimidamide;anthracene-9,10-dione.
Molecular Properties
| Compound Name | N'-amino-N-iminomethanimidamide;anthracene-9,10-dione |
| PubChem CID | 19842632 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N'-amino-N-iminomethanimidamide;anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.[H]/N=N/C=N/N |
| InChI | InChI=1S/C14H8O2.CH4N4/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;2-4-1-5-3/h1-8H;1-2H,3H2/b;4-2+,5-1+ |
| InChIKey | KCIOFMGIWZYJIS-NISNEZCHSA-N |
| XLogP | 2.38 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-N-iminomethanimidamide;anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-N-iminomethanimidamide;anthracene-9,10-dione?
The IUPAC name of N'-amino-N-iminomethanimidamide;anthracene-9,10-dione (CID 19842632) is N'-amino-N-iminomethanimidamide;anthracene-9,10-dione.
What is the SMILES notation for N'-amino-N-iminomethanimidamide;anthracene-9,10-dione?
The canonical SMILES for N'-amino-N-iminomethanimidamide;anthracene-9,10-dione is O=C1c2ccccc2C(=O)c2ccccc21.[H]/N=N/C=N/N.
What is the InChIKey of N'-amino-N-iminomethanimidamide;anthracene-9,10-dione?
The InChIKey is KCIOFMGIWZYJIS-NISNEZCHSA-N. The full InChI is InChI=1S/C14H8O2.CH4N4/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;2-4-1-5-3/h1-8H;1-2H,3H2/b;4-2+,5-1+.
What are the key properties of N'-amino-N-iminomethanimidamide;anthracene-9,10-dione?
N'-amino-N-iminomethanimidamide;anthracene-9,10-dione has a molecular weight of 280.29 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-N-iminomethanimidamide;anthracene-9,10-dione is sourced from PubChem (CID 19842632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).