About 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane
1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane (PubChem CID 19842781) has the molecular formula C15H24F2
and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane |
| PubChem CID | 19842781 |
| Molecular Formula | C15H24F2 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane |
| SMILES | FC(F)=CCC1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C15H24F2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h11-14H,1-10H2 |
| InChIKey | OBVQDXJKZYAACW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane?
The IUPAC name of 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane (CID 19842781) is 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane.
What is the SMILES notation for 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane?
The canonical SMILES for 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane is FC(F)=CCC1CCC(C2CCCCC2)CC1.
What is the InChIKey of 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane?
The InChIKey is OBVQDXJKZYAACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h11-14H,1-10H2.
What are the key properties of 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane?
1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane has a molecular weight of 242.35 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(3,3-difluoroprop-2-enyl)cyclohexane is sourced from PubChem (CID 19842781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).