About 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane
1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane (PubChem CID 19842835) has the molecular formula C17H28F2
and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane.
Molecular Properties
| Compound Name | 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane |
| PubChem CID | 19842835 |
| Molecular Formula | C17H28F2 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane |
| SMILES | CC1CCC(C2CCC(CCC=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H28F2/c1-13-5-9-15(10-6-13)16-11-7-14(8-12-16)3-2-4-17(18)19/h4,13-16H,2-3,5-12H2,1H3 |
| InChIKey | KJNWAJBLTVRWQM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane?
The IUPAC name of 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane (CID 19842835) is 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane.
What is the SMILES notation for 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane?
The canonical SMILES for 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane is CC1CCC(C2CCC(CCC=C(F)F)CC2)CC1.
What is the InChIKey of 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane?
The InChIKey is KJNWAJBLTVRWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28F2/c1-13-5-9-15(10-6-13)16-11-7-14(8-12-16)3-2-4-17(18)19/h4,13-16H,2-3,5-12H2,1H3.
What are the key properties of 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane?
1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane has a molecular weight of 270.41 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorobut-3-enyl)-4-(4-methylcyclohexyl)cyclohexane is sourced from PubChem (CID 19842835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).