About 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate
4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate (PubChem CID 19843269) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate.
Molecular Properties
| Compound Name | 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate |
| PubChem CID | 19843269 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate |
| SMILES | Cn1cc(C(N)=O)c(=O)c2sccc21.O |
| InChI | InChI=1S/C9H8N2O2S.H2O/c1-11-4-5(9(10)13)7(12)8-6(11)2-3-14-8;/h2-4H,1H3,(H2,10,13);1H2 |
| InChIKey | XPSBWVFEVBMUDB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate?
The IUPAC name of 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate (CID 19843269) is 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate.
What is the SMILES notation for 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate?
The canonical SMILES for 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate is Cn1cc(C(N)=O)c(=O)c2sccc21.O.
What is the InChIKey of 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate?
The InChIKey is XPSBWVFEVBMUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S.H2O/c1-11-4-5(9(10)13)7(12)8-6(11)2-3-14-8;/h2-4H,1H3,(H2,10,13);1H2.
What are the key properties of 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate?
4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate has a molecular weight of 226.26 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide;hydrate is sourced from PubChem (CID 19843269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).