C34H48N8O4+2 — CID 19843401
4-[3-[3,5-dioxo-4-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazin-1-yl]butan-2-yl]-1-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazine-2,6-dione (PubChem CID 19843401) has the molecular formula C34H48N8O4+2 and a molecular weight of 632.81 g/mol. Its IUPAC name is 4-[3-[3,5-dioxo-4-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazin-1-yl]butan-2-yl]-1-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazine-2,6-dione.
| Compound Name | 4-[3-[3,5-dioxo-4-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazin-1-yl]butan-2-yl]-1-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 19843401 |
| Molecular Formula | C34H48N8O4+2 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.38 |
| IUPAC Name | 4-[3-[3,5-dioxo-4-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazin-1-yl]butan-2-yl]-1-[(1-phenylpiperazin-1-ium-1-yl)methyl]piperazine-2,6-dione |
| SMILES | CC(C(C)N1CC(=O)N(C[N+]2(c3ccccc3)CCNCC2)C(=O)C1)N1CC(=O)N(C[N+]2(c3ccccc3)CCNCC2)C(=O)C1 |
| InChI | InChI=1S/C34H48N8O4/c1-27(37-21-31(43)39(32(44)22-37)25-41(17-13-35-14-18-41)29-9-5-3-6-10-29)28(2)38-23-33(45)40(34(46)24-38)26-42(19-15-36-16-20-42)30-11-7-4-8-12-30/h3-12,27-28,35-36H,13-26H2,1-2H3/q+2 |
| InChIKey | LGRNAXNOWZXMJU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|