About 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine
1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine (PubChem CID 19844626) has the molecular formula C23H28F2N2O
and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine.
Molecular Properties
| Compound Name | 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine |
| PubChem CID | 19844626 |
| Molecular Formula | C23H28F2N2O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(CCOC(C)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H28F2N2O/c1-3-12-26-13-15-27(16-14-26)17-18-28-23(2,19-4-8-21(24)9-5-19)20-6-10-22(25)11-7-20/h3-11H,1,12-18H2,2H3 |
| InChIKey | FLLFOLTUBIVBQP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine?
The IUPAC name of 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine (CID 19844626) is 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine.
What is the SMILES notation for 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine?
The canonical SMILES for 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine is C=CCN1CCN(CCOC(C)(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine?
The InChIKey is FLLFOLTUBIVBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2N2O/c1-3-12-26-13-15-27(16-14-26)17-18-28-23(2,19-4-8-21(24)9-5-19)20-6-10-22(25)11-7-20/h3-11H,1,12-18H2,2H3.
What are the key properties of 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine?
1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine has a molecular weight of 386.49 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1,1-bis(4-fluorophenyl)ethoxy]ethyl]-4-prop-2-enylpiperazine is sourced from PubChem (CID 19844626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).