C15H12Br2N4O3 — CID 19845065
N'-(2,6-dibromophenyl)-N-[2-(hydrazinecarbonyl)phenyl]oxamide (PubChem CID 19845065) has the molecular formula C15H12Br2N4O3 and a molecular weight of 456.09 g/mol. Its IUPAC name is N'-(2,6-dibromophenyl)-N-[2-(hydrazinecarbonyl)phenyl]oxamide.
| Compound Name | N'-(2,6-dibromophenyl)-N-[2-(hydrazinecarbonyl)phenyl]oxamide |
|---|---|
| PubChem CID | 19845065 |
| Molecular Formula | C15H12Br2N4O3 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | N'-(2,6-dibromophenyl)-N-[2-(hydrazinecarbonyl)phenyl]oxamide |
| SMILES | NNC(=O)c1ccccc1NC(=O)C(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C15H12Br2N4O3/c16-9-5-3-6-10(17)12(9)20-15(24)14(23)19-11-7-2-1-4-8(11)13(22)21-18/h1-7H,18H2,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | HWHVCBUORNTWMU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|