About N'-(2-aminophenoxy)oxamide
N'-(2-aminophenoxy)oxamide (PubChem CID 19845141) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is N'-(2-aminophenoxy)oxamide.
Molecular Properties
| Compound Name | N'-(2-aminophenoxy)oxamide |
| PubChem CID | 19845141 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | N'-(2-aminophenoxy)oxamide |
| SMILES | NC(=O)C(=O)NOc1ccccc1N |
| InChI | InChI=1S/C8H9N3O3/c9-5-3-1-2-4-6(5)14-11-8(13)7(10)12/h1-4H,9H2,(H2,10,12)(H,11,13) |
| InChIKey | KFFIRJVNPORUJI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-aminophenoxy)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminophenoxy)oxamide?
The IUPAC name of N'-(2-aminophenoxy)oxamide (CID 19845141) is N'-(2-aminophenoxy)oxamide.
What is the SMILES notation for N'-(2-aminophenoxy)oxamide?
The canonical SMILES for N'-(2-aminophenoxy)oxamide is NC(=O)C(=O)NOc1ccccc1N.
What is the InChIKey of N'-(2-aminophenoxy)oxamide?
The InChIKey is KFFIRJVNPORUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c9-5-3-1-2-4-6(5)14-11-8(13)7(10)12/h1-4H,9H2,(H2,10,12)(H,11,13).
What are the key properties of N'-(2-aminophenoxy)oxamide?
N'-(2-aminophenoxy)oxamide has a molecular weight of 195.18 g/mol, XLogP of -0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminophenoxy)oxamide is sourced from PubChem (CID 19845141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).