About 3-octyl-1,3-dihydropyrrol-2-one
3-octyl-1,3-dihydropyrrol-2-one (PubChem CID 19845201) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-octyl-1,3-dihydropyrrol-2-one.
Molecular Properties
| Compound Name | 3-octyl-1,3-dihydropyrrol-2-one |
| PubChem CID | 19845201 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3-octyl-1,3-dihydropyrrol-2-one |
| SMILES | CCCCCCCCC1C=CNC1=O |
| InChI | InChI=1S/C12H21NO/c1-2-3-4-5-6-7-8-11-9-10-13-12(11)14/h9-11H,2-8H2,1H3,(H,13,14) |
| InChIKey | QALDLWOJOGQCSD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octyl-1,3-dihydropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octyl-1,3-dihydropyrrol-2-one?
The IUPAC name of 3-octyl-1,3-dihydropyrrol-2-one (CID 19845201) is 3-octyl-1,3-dihydropyrrol-2-one.
What is the SMILES notation for 3-octyl-1,3-dihydropyrrol-2-one?
The canonical SMILES for 3-octyl-1,3-dihydropyrrol-2-one is CCCCCCCCC1C=CNC1=O.
What is the InChIKey of 3-octyl-1,3-dihydropyrrol-2-one?
The InChIKey is QALDLWOJOGQCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-2-3-4-5-6-7-8-11-9-10-13-12(11)14/h9-11H,2-8H2,1H3,(H,13,14).
What are the key properties of 3-octyl-1,3-dihydropyrrol-2-one?
3-octyl-1,3-dihydropyrrol-2-one has a molecular weight of 195.31 g/mol, XLogP of 3.00, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octyl-1,3-dihydropyrrol-2-one is sourced from PubChem (CID 19845201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).